Products 1261836-07-0
CAS 1261836-07-0 is the registry number for 1-Chloro-2-(chloromethyl)-4-(trifluoromethoxy)benzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-chloro-2-(chloromethyl)-4-(trifluoromethoxy)benzene (CAS 1261836-07-0) is a chemical compound with the molecular formula C8H5Cl2F3O and a molecular weight of 245.02 g/mol. IUPAC name: 1-chloro-2-(chloromethyl)-4-(trifluoromethoxy)benzene. InChIKey: NSYFZJSOVVWENA-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3O |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | 1-chloro-2-(chloromethyl)-4-(trifluoromethoxy)benzene |
| InChIKey | NSYFZJSOVVWENA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)CCl)Cl |
Computed by PubChem (NCBI)