CAS 923675-42-7 appears in our catalog under these names: 1-(2,3-Dichlorophenyl)-2,2,2-trifluoroethan-1-ol, 95%, 1-(2,3-Dichlorophenyl)-2,2,2-trifluoroethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
1-(2,3-dichlorophenyl)-2,2,2-trifluoroethanol (CAS 923675-42-7) is a chemical compound with the molecular formula C8H5Cl2F3O and a molecular weight of 245.02 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)-2,2,2-trifluoroethanol. InChIKey: OMBRXWOUGCBKOA-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3O |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | OMBRXWOUGCBKOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(C(F)(F)F)O |
Computed by PubChem (NCBI)