cas: 79252-84-9 — see every product listed under this CAS number, including other names
1-(2-Hydroxyphenyl)pyrrolidine-2,5-dione 98% (CAS 79252-84-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A908522-250mg |
| cas | 79252-84-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 698.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A908522 |
1-(2-hydroxyphenyl)pyrrolidine-2,5-dione (CAS 79252-84-9) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 1-(2-hydroxyphenyl)pyrrolidine-2,5-dione. InChIKey: QGMHYVXVMJXSEK-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 1-(2-hydroxyphenyl)pyrrolidine-2,5-dione |
| InChIKey | QGMHYVXVMJXSEK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=CC=CC=C2O |
Computed by PubChem (NCBI)