cas: 31963-35-6 — see every product listed under this CAS number, including other names
1-(2-Phenoxyphenyl)methanamine hydrochloride, 95% (CAS 31963-35-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078475-100MG |
| cas | 31963-35-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 841.39 Pln | |
| Fluorochem | 5g | 2762.59 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2-phenoxyphenyl)methanamine;hydrochloride (CAS 31963-35-6) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: (2-phenoxyphenyl)methanamine;hydrochloride. InChIKey: USRYZTSPSJXQFU-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | (2-phenoxyphenyl)methanamine;hydrochloride |
| InChIKey | USRYZTSPSJXQFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2CN.Cl |
Computed by PubChem (NCBI)