cas: 31963-35-6 — see every product listed under this CAS number, including other names
1-(2-Phenoxyphenyl)methanamine hydrochloride, 97% (CAS 31963-35-6) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC49963CB |
| cas | 31963-35-6 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 311.05 Pln | |
| Thermo Scientific | 1g | 580.35 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
(2-phenoxyphenyl)methanamine;hydrochloride (CAS 31963-35-6) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: (2-phenoxyphenyl)methanamine;hydrochloride. InChIKey: USRYZTSPSJXQFU-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | (2-phenoxyphenyl)methanamine;hydrochloride |
| InChIKey | USRYZTSPSJXQFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2CN.Cl |
Computed by PubChem (NCBI)