CAS 24096-52-4 appears in our catalog under these names: 1-(3,5-Dichloro-phenyl)-pyrrole-2,5-dione, 95%, 1-(3,5-Dichloro-phenyl)-pyrrole-2,5-dione, 99%+(LC-MS),RG. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
1-(3,5-dichlorophenyl)pyrrole-2,5-dione (CAS 24096-52-4) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)pyrrole-2,5-dione. InChIKey: OSSFTHGZMNLASE-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)pyrrole-2,5-dione |
| InChIKey | OSSFTHGZMNLASE-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)