cas: 80789-69-1 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid, 98% (CAS 80789-69-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 161570050 |
| cas | 80789-69-1 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 96.66 Pln | |
| Thermo Scientific (Acros) | 25g | 277.96 Pln | |
| Thermo Scientific (Acros) | 100g | 841.89 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
1-(4-chlorophenyl)cyclopentane-1-carboxylic acid (CAS 80789-69-1) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid. InChIKey: QJNFJEMGWIQMJT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | QJNFJEMGWIQMJT-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)