cas: 80789-69-1 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)cyclopentanecarboxylic acid, 95% (CAS 80789-69-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219206-1G |
| cas | 80789-69-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 10g | 289.50 Pln | |
| Fluorochem | 25g | 497.76 Pln | |
| Fluorochem | 100g | 1690.05 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-chlorophenyl)cyclopentane-1-carboxylic acid (CAS 80789-69-1) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid. InChIKey: QJNFJEMGWIQMJT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | QJNFJEMGWIQMJT-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)