1-(4-Chlorophenyl)cyclopentanecarboxylic acid, 95%
cas: 80789-69-1 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)cyclopentanecarboxylic acid, 95% (CAS 80789-69-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A455746-5g |
| cas | 80789-69-1 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 25g | 520.56 Pln | |
| Ambeed | 100g | 1727.62 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 25g | 553.16 Pln | |
| BLDpharm | 100g | 1858.26 Pln | |
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 180.16 Pln | |
| Fluorochem | 10g | 305.12 Pln | |
| Fluorochem | 25g | 523.79 Pln | |
| Fluorochem | 100g | 1757.73 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-chlorophenyl)cyclopentane-1-carboxylic acid (CAS 80789-69-1) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid. InChIKey: QJNFJEMGWIQMJT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | QJNFJEMGWIQMJT-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-(4-Chlorophenyl)cyclopentanecarboxylic acid, 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid, 1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid, Cyclopentanecarboxylic acid, 1-(4-chlorophenyl)-, 1-(4-chlorophenyl)cyclopentanecarboxylic, Oprea1_129234, 1-(4-Chlorophenyl)cyclopentanecarboxylicacid, 1-(4-chloro phenyl)cyclopentanecarboxylic acid, 1-(4-chloro-phenyl)-cyclopentylcarboxylic acid, 1-(4-chlorophenyl) cyclopentanecarboxylic acid