cas: 58880-37-8 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)cyclohexanecarboxylic acid 95% (CAS 58880-37-8) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A533860-500g |
| cas | 58880-37-8 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 14315.56 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 1010.06 Pln | |
| Ambeed | 100g | 3630.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A533860 |
1-(4-chlorophenyl)cyclohexane-1-carboxylic acid (CAS 58880-37-8) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclohexane-1-carboxylic acid. InChIKey: UPNXUJXIIZGXLQ-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 1-(4-chlorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | UPNXUJXIIZGXLQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)