CAS 58880-37-8 appears in our catalog under these names: 1-(4-chlorophenyl)cyclohexane-1-carboxylic acid, 95%, 1-(4-Chlorophenyl)cyclohexane-1-carboxylic acid, 95% , 1-(4-Chlorophenyl)cyclohexanecarboxylic acid, 1-(4-Chlorophenyl)cyclohexanecarboxylic acid 95%, 1-(4-Chlorophenyl)cyclohexanecarboxylic acid, 98%, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 500g, 100g, 250mg, 10g, 20g.
1-(4-chlorophenyl)cyclohexane-1-carboxylic acid (CAS 58880-37-8) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclohexane-1-carboxylic acid. InChIKey: UPNXUJXIIZGXLQ-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 1-(4-chlorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | UPNXUJXIIZGXLQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)