Products 1368749-51-2

CAS 1368749-51-2 is the registry number for Atovaquone Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.

4-(2-chlorophenyl)cyclohexane-1-carboxylic acid (CAS 1368749-51-2) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 4-(2-chlorophenyl)cyclohexane-1-carboxylic acid. InChIKey: WVKUFCLPSAKMMW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15ClO2
Molecular weight238.71 g/mol
IUPAC name4-(2-chlorophenyl)cyclohexane-1-carboxylic acid
InChIKeyWVKUFCLPSAKMMW-UHFFFAOYSA-N
SMILESC1CC(CCC1C2=CC=CC=C2Cl)C(=O)O

Computed by PubChem (NCBI)