CAS 2206709-61-5 appears in our catalog under these names: (E)-Ethyl 3-(4-chloro-3,5-dimethylphenyl)acrylate, 95%, (E)-Ethyl 3-(4-chloro-3,5-dimethylphenyl)acrylate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl (E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoate (CAS 2206709-61-5) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: ethyl (E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoate. InChIKey: MPUVMOIZCVBBAQ-AATRIKPKSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | ethyl (E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoate |
| InChIKey | MPUVMOIZCVBBAQ-AATRIKPKSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC(=C(C(=C1)C)Cl)C |
Computed by PubChem (NCBI)