cas: 58880-37-8 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)cyclohexanecarboxylic acid, 98%, 98% (CAS 58880-37-8) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CYT-500g |
| cas | 58880-37-8 |
| size | 500g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 17256.00 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 314.00 Pln | |
| Chemat | 10g | 530.00 Pln | |
| Chemat | 25g | 1101.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-chlorophenyl)cyclohexane-1-carboxylic acid (CAS 58880-37-8) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclohexane-1-carboxylic acid. InChIKey: UPNXUJXIIZGXLQ-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 1-(4-chlorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | UPNXUJXIIZGXLQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)