Products 1545895-13-3

CAS 1545895-13-3 is the registry number for 3-(4-Chlorophenyl)-2-cyclopropyl-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(4-chlorophenyl)-2-cyclopropyl-2-methylpropanoic acid (CAS 1545895-13-3) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 3-(4-chlorophenyl)-2-cyclopropyl-2-methylpropanoic acid. InChIKey: GCDTZTAQHRDIID-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15ClO2
Molecular weight238.71 g/mol
IUPAC name3-(4-chlorophenyl)-2-cyclopropyl-2-methylpropanoic acid
InChIKeyGCDTZTAQHRDIID-UHFFFAOYSA-N
SMILESCC(CC1=CC=C(C=C1)Cl)(C2CC2)C(=O)O

Computed by PubChem (NCBI)