CAS 95233-37-7 appears in our catalog under these names: 4-(4-Chlorophenyl)cyclohexanecarboxylic acid, 98%, (E)-4-(4-Chlorophenyl)cyclohexanecarboxylic acid, 97% , 4-(4-Chlorophenyl)cyclohexanecarboxylic acid 98% (trans), 4-(4-Chlorophenyl)cyclohexanecarboxylic acid, 98% (trans), 98% (trans). Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 500g, 1g, 10g, 1kg.
4-(4-chlorophenyl)cyclohexane-1-carboxylic acid (CAS 95233-37-7) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid. InChIKey: NXXDIEYTMQYWJU-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | NXXDIEYTMQYWJU-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)