CAS 1346600-43-8 appears in our catalog under these names: cis-4-(4-Chlorophenyl)cyclohexanecarboxylic acid, 97%, Atovaquone Related Compound 1, cis-4-(4-Chlorophenyl)cyclohexanecarboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
4-(4-chlorophenyl)cyclohexane-1-carboxylic acid (CAS 1346600-43-8) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid. InChIKey: NXXDIEYTMQYWJU-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | NXXDIEYTMQYWJU-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)