Products 1429309-23-8

CAS 1429309-23-8 is the registry number for 4-Oxo-4-(4-propylphenyl)butanoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-oxo-4-(4-propylphenyl)butanoyl chloride (CAS 1429309-23-8) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 4-oxo-4-(4-propylphenyl)butanoyl chloride. InChIKey: XOVMHZCFGDNCTI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15ClO2
Molecular weight238.71 g/mol
IUPAC name4-oxo-4-(4-propylphenyl)butanoyl chloride
InChIKeyXOVMHZCFGDNCTI-UHFFFAOYSA-N
SMILESCCCC1=CC=C(C=C1)C(=O)CCC(=O)Cl

Computed by PubChem (NCBI)