CAS 49708-81-8 appears in our catalog under these names: Atovaquone Impurity 2, trans-4-(4-Chlorophenyl)cyclohexanecarboxylic Acid, >95% (HPLC), trans-4-(4-Chlorophenyl)cyclohexanecarboxylic Acid, trans-4-(4-Chlorophenyl)cyclohexane-1-carboxylic acid, 98% , trans-4-(4-Chlorophenyl)cyclohexanecarboxylic acid 98%. Offered by: Chemat Brand, TRC, Mikromol, Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: on request, 1g, 2,5g, 500mg, 25mg, 25g, 100g, 1000g.
4-(4-chlorophenyl)cyclohexane-1-carboxylic acid (CAS 49708-81-8) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid. InChIKey: NXXDIEYTMQYWJU-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | NXXDIEYTMQYWJU-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)