cas: 1255792-05-2 — see every product listed under this CAS number, including other names
1-(5-Methoxy-2-nitro-4-(prop-2-yn-1-yloxy)phenyl)ethan-1-ol 95% (CAS 1255792-05-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A800070-10g |
| cas | 1255792-05-2 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 3502.06 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 1983.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A800070 |
1-(5-methoxy-2-nitro-4-prop-2-ynoxyphenyl)ethanol (CAS 1255792-05-2) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 1-(5-methoxy-2-nitro-4-prop-2-ynoxyphenyl)ethanol. InChIKey: DACNMURXMLMAPR-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 1-(5-methoxy-2-nitro-4-prop-2-ynoxyphenyl)ethanol |
| InChIKey | DACNMURXMLMAPR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1[N+](=O)[O-])OCC#C)OC)O |
Computed by PubChem (NCBI)