cas: 5444-61-1 — see every product listed under this CAS number, including other names
1-BENZYL-1H-PYRAZOLO[3,4-D]PYRIMIDIN-4-AMINE, 96% (CAS 5444-61-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F501769-250MG |
| cas | 5444-61-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 638.33 Pln | |
| Fluorochem | 5g | 1700.46 Pln | |
| Fluorochem | 10g | 3267.62 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-benzylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 5444-61-1) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 1-benzylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: MFJROXVGGWPNPO-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 1-benzylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | MFJROXVGGWPNPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=NC=NC(=C3C=N2)N |
Computed by PubChem (NCBI)