cas: 5444-61-1 — see every product listed under this CAS number, including other names
1-benzyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine, 96%, 96% (CAS 5444-61-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E1Z5-100mg |
| cas | 5444-61-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 1g | 539.60 Pln | |
| Chemat | 5g | 1490.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-benzylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 5444-61-1) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 1-benzylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: MFJROXVGGWPNPO-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 1-benzylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | MFJROXVGGWPNPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=NC=NC(=C3C=N2)N |
Computed by PubChem (NCBI)