1-Benzyl-1H-Pyrazolo[3,4-D]Pyrimidin-4-Amine, 96%
cas: 5444-61-1 — see every product listed under this CAS number, including other names
1-Benzyl-1H-Pyrazolo[3,4-D]Pyrimidin-4-Amine, 96% (CAS 5444-61-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11E1Z5-100mg |
| cas | 5444-61-1 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 539.60 Pln | |
| Chemat | 5g | 1490.00 Pln | |
| Fluorochem | 250mg | 305.12 Pln | |
| Fluorochem | 1g | 674.78 Pln | |
| Fluorochem | 5g | 1773.35 Pln | |
| Fluorochem | 10g | 3371.75 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-benzylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 5444-61-1) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 1-benzylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: MFJROXVGGWPNPO-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 1-benzylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | MFJROXVGGWPNPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=NC=NC(=C3C=N2)N |
Computed by PubChem (NCBI)