1-Chloro-2,4-difluoro-3-nitrobenzene, 95%
cas: 1151767-58-6 — see every product listed under this CAS number, including other names
1-Chloro-2,4-difluoro-3-nitrobenzene, 95% (CAS 1151767-58-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 2.5g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch111GD5-100mg |
| cas | 1151767-58-6 |
| size | 100mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 746.00 Pln | |
| Chemat | 10g | 1427.60 Pln | |
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 2.5g | 612.30 Pln | |
| Fluorochem | 5g | 1143.37 Pln | |
| Fluorochem | 10g | 2215.90 Pln | |
| Fluorochem | 25g | 5360.63 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-chloro-2,4-difluoro-3-nitrobenzene (CAS 1151767-58-6) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 1-chloro-2,4-difluoro-3-nitrobenzene. InChIKey: OHPIHTQPKGZTFB-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 1-chloro-2,4-difluoro-3-nitrobenzene |
| InChIKey | OHPIHTQPKGZTFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)[N+](=O)[O-])F)Cl |
Computed by PubChem (NCBI)