Products 3847-58-3
CAS 3847-58-3 appears in our catalog under these names: 3-Chloro-2,4-difluoronitrobenzene 97%, 3-Chloro-2,4-difluoronitrobenzene, 97%, 3-Chloro-2,4-difluoronitrobenzene, >95% (HPLC), 2–Chloro–1,3–difluoro–4–nitrobenzene, 2-Chloro-1,3-difluoro-4-nitrobenzene, >98.0%(GC). Offered by: Ambeed, Fluorochem, TRC, GLPBio, TCI. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
2-chloro-1,3-difluoro-4-nitrobenzene (CAS 3847-58-3) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 2-chloro-1,3-difluoro-4-nitrobenzene. InChIKey: CTVBVNKEMCGZDF-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 2-chloro-1,3-difluoro-4-nitrobenzene |
| InChIKey | CTVBVNKEMCGZDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)Cl)F |
Computed by PubChem (NCBI)