CAS 136272-31-6 appears in our catalog under these names: 4-Chloro-2,6-difluoronitrobenzene 95%, 4-Chloro-2,6-difluoronitrobenzene, 95%, 95%, 4-CHLORO-2,6-DIFLUORONITROBENZENE, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
5-chloro-1,3-difluoro-2-nitrobenzene (CAS 136272-31-6) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 5-chloro-1,3-difluoro-2-nitrobenzene. InChIKey: SYCSOTAABUJOHB-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 5-chloro-1,3-difluoro-2-nitrobenzene |
| InChIKey | SYCSOTAABUJOHB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)Cl |
Computed by PubChem (NCBI)