CAS 169468-83-1 appears in our catalog under these names: 2–Chloro–3,4–difluoronitrobenzene, 2-Chloro-3,4-difluoronitrobenzene 98%, 2-Chloro-3,4-difluoronitrobenzene, 97%, 97%, 2-Chloro-3,4-difluoronitrobenzene, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1mg, 250mg, 1g, 100g, 10g, 50g.
3-chloro-1,2-difluoro-4-nitrobenzene (CAS 169468-83-1) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 3-chloro-1,2-difluoro-4-nitrobenzene. InChIKey: MOKXBJZRTOPIFB-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 3-chloro-1,2-difluoro-4-nitrobenzene |
| InChIKey | MOKXBJZRTOPIFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Cl)F)F |
Computed by PubChem (NCBI)