CAS 1481-68-1 appears in our catalog under these names: 1-Chloro-2,4-difluoro-5-nitrobenzene 98%, 1-Chloro-2,4-difluoro-5-nitrobenzene, 95%, 95%, 5–Chloro–2,4–difluoronitrobenzene, 5-Chloro-2,4-difluoronitrobenzene, 95%. Offered by: Ambeed, Chemat, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
1-chloro-2,4-difluoro-5-nitrobenzene (CAS 1481-68-1) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 1-chloro-2,4-difluoro-5-nitrobenzene. InChIKey: UIOYEIHBWQTVJC-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 1-chloro-2,4-difluoro-5-nitrobenzene |
| InChIKey | UIOYEIHBWQTVJC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)