Products 851386-32-8
CAS 851386-32-8 appears in our catalog under these names: 4-Chloro-5，6-difluoronicotinic acid, 95%, 95%, 4-Chloro-5,6-difluoronicotinic acid, 95%. Offered by: Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 100mg, 5g, 10g, 25g, 100g, 250mg, 1g, 500mg.
4-chloro-5,6-difluoropyridine-3-carboxylic acid (CAS 851386-32-8) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 4-chloro-5,6-difluoropyridine-3-carboxylic acid. InChIKey: SQMYITSFQKNMHA-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 4-chloro-5,6-difluoropyridine-3-carboxylic acid |
| InChIKey | SQMYITSFQKNMHA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)