cas: 1805029-24-6 — see every product listed under this CAS number, including other names
1-Chloro-2,5-difluoro-3-nitrobenzene, 97% (CAS 1805029-24-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F362946-100MG |
| cas | 1805029-24-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 622.72 Pln | |
| Fluorochem | 5g | 2471.02 Pln | |
| Fluorochem | 25g | 8901.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-chloro-2,5-difluoro-3-nitrobenzene (CAS 1805029-24-6) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 1-chloro-2,5-difluoro-3-nitrobenzene. InChIKey: KEZVSFPNJJNPHU-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 1-chloro-2,5-difluoro-3-nitrobenzene |
| InChIKey | KEZVSFPNJJNPHU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)Cl)F |
Computed by PubChem (NCBI)