cas: 6276-03-5 — see every product listed under this CAS number, including other names
1-Fluorenecarboxylic Acid, >98.0%(HPLC)(T) (CAS 6276-03-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0541-1G |
| cas | 6276-03-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 206.86 Pln | |
| TCI | 5g | 713.33 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
9H-fluorene-1-carboxylic acid (CAS 6276-03-5) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 9H-fluorene-1-carboxylic acid. InChIKey: HTPXFGUCAUTOEL-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 9H-fluorene-1-carboxylic acid |
| InChIKey | HTPXFGUCAUTOEL-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)