cas: 6276-03-5 — see every product listed under this CAS number, including other names
1-Fluorenecarboxylic Acid, 98%(LC-MS),RG, 98%(LC-MS),RG (CAS 6276-03-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EBQ-100mg |
| cas | 6276-03-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 458.00 Pln | |
| Chemat | 5g | 976.40 Pln |
| purity | 98%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
9H-fluorene-1-carboxylic acid (CAS 6276-03-5) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 9H-fluorene-1-carboxylic acid. InChIKey: HTPXFGUCAUTOEL-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 9H-fluorene-1-carboxylic acid |
| InChIKey | HTPXFGUCAUTOEL-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)