cas: 13041-63-9 — see every product listed under this CAS number, including other names
1-Naphthalenecarboxylic acid, 4-hydroxy-, methyl ester, 95%, 95% (CAS 13041-63-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111UEJ-100mg |
| cas | 13041-63-9 |
| size | 100mg |
| availability | 4.819g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 962.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-hydroxynaphthalene-1-carboxylate (CAS 13041-63-9) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 4-hydroxynaphthalene-1-carboxylate. InChIKey: IVAXJJJTBDVHEA-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 4-hydroxynaphthalene-1-carboxylate |
| InChIKey | IVAXJJJTBDVHEA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C2=CC=CC=C21)O |
Computed by PubChem (NCBI)