cas: 13041-63-9 — see every product listed under this CAS number, including other names
Methyl 4-hydroxy-1-naphthoate 98% (CAS 13041-63-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A337297-100mg |
| cas | 13041-63-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 459.38 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1221.44 Pln | |
| Ambeed | 5g | 3390.81 Pln | |
| Ambeed | 10g | 5715.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A337297 |
Methyl 4-hydroxynaphthalene-1-carboxylate (CAS 13041-63-9) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 4-hydroxynaphthalene-1-carboxylate. InChIKey: IVAXJJJTBDVHEA-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 4-hydroxynaphthalene-1-carboxylate |
| InChIKey | IVAXJJJTBDVHEA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C2=CC=CC=C21)O |
Computed by PubChem (NCBI)