1H-INDOLE-5-SULFONYL CHLORIDE, 95%
cas: 1094209-33-2 — see every product listed under this CAS number, including other names
1H-INDOLE-5-SULFONYL CHLORIDE, 95% (CAS 1094209-33-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11025N-100mg |
| cas | 1094209-33-2 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 779.60 Pln | |
| Chemat | 1g | 1850.00 Pln | |
| Chemat | 5g | 7053.20 Pln | |
| Chemat | 10g | 13979.60 Pln | |
| Fluorochem | 10g | 25546.23 Pln | |
| Fluorochem | 100mg | 794.53 Pln | |
| Fluorochem | 250mg | 1445.34 Pln | |
| Fluorochem | 1g | 3418.61 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1H-indole-5-sulfonyl chloride (CAS 1094209-33-2) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: 1H-indole-5-sulfonyl chloride. InChIKey: MZGMZFOGQIBZLB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | 1H-indole-5-sulfonyl chloride |
| InChIKey | MZGMZFOGQIBZLB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2)C=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)