cas: 21470-37-1 — see every product listed under this CAS number, including other names
1H-Indole, 2-[1,1'-biphenyl]-4-yl- (CAS 21470-37-1) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BBK9-200mg |
| cas | 21470-37-1 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 222.80 Pln | |
| Chemat | 1g | 654.80 Pln | |
| Chemat | 5g | 2334.80 Pln |
| delivery time | 3 weeks |
|---|
2-(4-phenylphenyl)-1H-indole (CAS 21470-37-1) is a chemical compound with the molecular formula C20H15N and a molecular weight of 269.3 g/mol. IUPAC name: 2-(4-phenylphenyl)-1H-indole. InChIKey: IZQXDFSSLHWRBK-UHFFFAOYSA-N.
| Molecular formula | C20H15N |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 2-(4-phenylphenyl)-1H-indole |
| InChIKey | IZQXDFSSLHWRBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)