cas: 117140-77-9 — see every product listed under this CAS number, including other names
1H-Indole-2,5-dicarboxylic acid, 97% (CAS 117140-77-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F463421-5G |
| cas | 117140-77-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 404.04 Pln | |
| Fluorochem | 25g | 919.49 Pln | |
| Fluorochem | 100g | 3507.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1H-indole-2,5-dicarboxylic acid (CAS 117140-77-9) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 1H-indole-2,5-dicarboxylic acid. InChIKey: MUABQYJAPOQWCH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 1H-indole-2,5-dicarboxylic acid |
| InChIKey | MUABQYJAPOQWCH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)