CAS 25543-10-6 appears in our catalog under these names: Methyl 1,3-dioxo-2,3-dihydro-1h-isoindole-2-carboxylate, 95%, Methyl 1,3-dioxoisoindoline-2-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Methyl 1,3-dioxoisoindole-2-carboxylate (CAS 25543-10-6) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: methyl 1,3-dioxoisoindole-2-carboxylate. InChIKey: KRLWOFRQXDUIKD-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | methyl 1,3-dioxoisoindole-2-carboxylate |
| InChIKey | KRLWOFRQXDUIKD-UHFFFAOYSA-N |
| SMILES | COC(=O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)