cas: 103027-97-0 — see every product listed under this CAS number, including other names
1H-Indole-2,6-dicarboxylic acid (CAS 103027-97-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F064539-1G |
| cas | 103027-97-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3887.19 Pln | |
| Fluorochem | 5g | 10775.39 Pln |
| delivery time | 3-4 weeks |
|---|
1H-indole-2,6-dicarboxylic acid (CAS 103027-97-0) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 1H-indole-2,6-dicarboxylic acid. InChIKey: WXXRCNKKYCNYFF-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 1H-indole-2,6-dicarboxylic acid |
| InChIKey | WXXRCNKKYCNYFF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=C2)C(=O)O |
Computed by PubChem (NCBI)