cas: 6720-26-9 — see every product listed under this CAS number, including other names
2'-Formyl-biphenyl-2-carboxylic acid, 96% (CAS 6720-26-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033175-100MG |
| cas | 6720-26-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 732.05 Pln | |
| Fluorochem | 5g | 2106.57 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-formylphenyl)benzoic acid (CAS 6720-26-9) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 2-(2-formylphenyl)benzoic acid. InChIKey: NXEWGTWUNXITOI-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-(2-formylphenyl)benzoic acid |
| InChIKey | NXEWGTWUNXITOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)