CAS 222180-20-3 appears in our catalog under these names: 3-(4-Formylphenyl)benzoic acid, 4'-Formylbiphenyl-3-carboxylic acid, 98%, 4'-Formyl-biphenyl-3-carboxylic acid, 98%, 4'-Formyl-[1,1'-biphenyl]-3-carboxylic acid 98%, 4'-Formyl-[1,1'-biphenyl]-3-carboxylic acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 2,5g, 1g, 100g, 25g, 5g, 250mg.
3-(4-formylphenyl)benzoic acid (CAS 222180-20-3) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 3-(4-formylphenyl)benzoic acid. InChIKey: PLPKINAPTMTZJU-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-(4-formylphenyl)benzoic acid |
| InChIKey | PLPKINAPTMTZJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)