CAS 92262-75-4 appears in our catalog under these names: Naphtho[2,1-b]furan-1-yl-acetic acid, 95%, Naphtho(2,1-b)furan-1-yl-aceticacid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-benzo[e][1]benzofuran-1-ylacetic acid (CAS 92262-75-4) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 2-benzo[e][1]benzofuran-1-ylacetic acid. InChIKey: XPQWIAKMWGZBAN-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-benzo[e][1]benzofuran-1-ylacetic acid |
| InChIKey | XPQWIAKMWGZBAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C(=CO3)CC(=O)O |
Computed by PubChem (NCBI)