CAS 480-22-8 is the registry number for 1,8,9-Trihydroxyanthracene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
Anthracene-1,8,9-triol is an anthracenetriol that is anthracene substituted by hydroxy groups at positions 1, 8 and 9. It is a tautomer of an anthralin.
Source: ChEBI
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | anthracene-1,8,9-triol |
| InChIKey | YUTJCNNFTOIOGT-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=C(C(=CC=C3)O)C(=C2C(=C1)O)O |
Computed by PubChem (NCBI)