CAS 32730-06-6 is the registry number for Methyl naphtho[2,1-b]furan-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl benzo[e][1]benzofuran-2-carboxylate (CAS 32730-06-6) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: methyl benzo[e][1]benzofuran-2-carboxylate. InChIKey: JKFZKJRWDIOSFR-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | methyl benzo[e][1]benzofuran-2-carboxylate |
| InChIKey | JKFZKJRWDIOSFR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(O1)C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)