Products 32730-06-6

CAS 32730-06-6 is the registry number for Methyl naphtho[2,1-b]furan-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl benzo[e][1]benzofuran-2-carboxylate (CAS 32730-06-6) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: methyl benzo[e][1]benzofuran-2-carboxylate. InChIKey: JKFZKJRWDIOSFR-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10O3
Molecular weight226.23 g/mol
IUPAC namemethyl benzo[e][1]benzofuran-2-carboxylate
InChIKeyJKFZKJRWDIOSFR-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=C(O1)C=CC3=CC=CC=C32

Computed by PubChem (NCBI)