CAS 205871-52-9 appears in our catalog under these names: 3-(2-Formylphenyl)benzoic acid, 98%, 3-(2-formylphenyl)benzoic acid, 2'-Formyl-[1,1'-biphenyl]-3-carboxylic acid 95%, 2'-Formylbiphenyl-3-carboxylic acid, 97%, 2'-Formyl-[1,1'-biphenyl]-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 0,5g, 250mg, 100mg, 50mg.
3-(2-formylphenyl)benzoic acid (CAS 205871-52-9) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 3-(2-formylphenyl)benzoic acid. InChIKey: NWVOXGWJNSOFTE-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-(2-formylphenyl)benzoic acid |
| InChIKey | NWVOXGWJNSOFTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)