CAS 579-18-0 appears in our catalog under these names: 3-Benzoylbenzoic acid, 98%, 3–Benzoylbenzoic acid, 3-Benzoylbenzoic acid, 98% , Benzophenone-3-carboxylic acid, 3-Benzoylbenzoic acid 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed. Available pack sizes: 1g, 25g, 5g, 10g, 50g, 100g, 250g, 250mg.
3-benzoylbenzoic acid (CAS 579-18-0) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 3-benzoylbenzoic acid. InChIKey: AXJXRLHTQQONQR-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-benzoylbenzoic acid |
| InChIKey | AXJXRLHTQQONQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)