CAS 222180-19-0 appears in our catalog under these names: 3'-Formylbiphenyl-3-carboxylic acid, 96%, 3'-Formyl-biphenyl-3-carboxylic acid, 3'-Formyl(1,1'-biphenyl)-3-carboxylic acid, 97% , 3'-Formyl-biphenyl-3-carboxylic acid, 97%, 3'-Formyl-[1,1'-biphenyl]-3-carboxylic acid, 95%. Offered by: Combi-blocks, Biosynth, Thermo Scientific, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 2,5g, 250MG, 100mg.
3-(3-formylphenyl)benzoic acid (CAS 222180-19-0) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 3-(3-formylphenyl)benzoic acid. InChIKey: QOCUSJPHQSKJJR-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-(3-formylphenyl)benzoic acid |
| InChIKey | QOCUSJPHQSKJJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)C(=O)O)C=O |
Computed by PubChem (NCBI)