CAS 49590-51-4 appears in our catalog under these names: Bis(2-formylphenyl) ether, 95%, 2,2'-Oxydibenzaldehyde, 95%, Bis(2–formylphenyl) Ether, Bis(2-formylphenyl) Ether, >98.0%(GC), 2,2'-Oxydibenzaldehyde 95%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 10g, 1g, 5g, 200mg, 250mg.
2-(2-formylphenoxy)benzaldehyde (CAS 49590-51-4) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 2-(2-formylphenoxy)benzaldehyde. InChIKey: LMJZLKFWMQOYKU-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-(2-formylphenoxy)benzaldehyde |
| InChIKey | LMJZLKFWMQOYKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)OC2=CC=CC=C2C=O |
Computed by PubChem (NCBI)