cas: 49590-51-4 — see every product listed under this CAS number, including other names
2,2'-Oxydibenzaldehyde 95% (CAS 49590-51-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217526-250mg |
| cas | 49590-51-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1505.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A217526 |
2-(2-formylphenoxy)benzaldehyde (CAS 49590-51-4) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 2-(2-formylphenoxy)benzaldehyde. InChIKey: LMJZLKFWMQOYKU-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-(2-formylphenoxy)benzaldehyde |
| InChIKey | LMJZLKFWMQOYKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)OC2=CC=CC=C2C=O |
Computed by PubChem (NCBI)