cas: 85160-84-5 — see every product listed under this CAS number, including other names
2,2-DIMETHYL-6-NITRO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 98% (CAS 85160-84-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F471371-1G |
| cas | 85160-84-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1471.37 Pln | |
| Fluorochem | 10g | 2882.34 Pln | |
| Fluorochem | 25g | 7120.43 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,2-dimethyl-6-nitro-4H-1,4-benzoxazin-3-one (CAS 85160-84-5) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 2,2-dimethyl-6-nitro-4H-1,4-benzoxazin-3-one. InChIKey: YKXZRZGZJZYBBH-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 2,2-dimethyl-6-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | YKXZRZGZJZYBBH-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=CC(=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)