CAS 61948-70-7 appears in our catalog under these names: 2,4(1H,3H)-Quinazolinedione, 7,8-dimethoxy-, 95%, 7,8-Dimethoxyquinazoline-2,4(1H,3H)-dione, 95+%, 7,8–Dimethoxyquinazoline–2,4(1H,3H)–dione. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
7,8-dimethoxy-1H-quinazoline-2,4-dione (CAS 61948-70-7) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 7,8-dimethoxy-1H-quinazoline-2,4-dione. InChIKey: ZNCZFFBFTRODRN-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 7,8-dimethoxy-1H-quinazoline-2,4-dione |
| InChIKey | ZNCZFFBFTRODRN-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=O)NC(=O)N2)OC |
Computed by PubChem (NCBI)